Spirotryprostatin B

Spirotryprostatin B

Names
Preferred IUPAC name (2S,3S,5aS)-2′-Hydroxy-3-(2-methylprop-1-en-1-yl)-5a,6,7,8-tetrahydro-3H,5H,10H-spiro[dipyrrolo[1,2-a:1′,2′-d]pyrazole-2,3′-indole]-5,10-dione
Identifiers
CAS Number	182234-26-0 N[1]
3D model (JSmol)	Interactive image
ChemSpider	8104599
PubChem CID	9928968
InChI InChI=1S/C21H21N3O3/c1-12(2)10-17-21(13-6-3-4-7-14(13)22-20(21)27)11-16-18(25)23-9-5-8-15(23)19(26)24(16)17/h3-4,6-7,10-11,15,17H,5,8-9H2,1-2H3,(H,22,27)/t15-,17-,21-/m0/s1 Key: IWUYVKKHPNFWJG-WJPUGNRLSA-N
SMILES O=C1C=3N(C(=O)[C@H]2N1CCC2)[C@@H](\C=C(/C)C)[C@]5(C=3)c4ccccc4NC5=O
Properties
Chemical formula	C21H21N3O3
Molar mass	363.417 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Y verify (what is YN ?) Infobox references

Spirotryprostatin B is an indolic alkaloid found in the Aspergillus fumigatus fungus that belongs to a class of naturally occurring 2,5-diketopiperazines.^[1] Spirotryprostatin B and several other indolic alkaloids (including Spirotryprostatin A, as well as other tryprostatins and cyclotryprostatins) have been found to have anti-mitotic properties, and as such they have become of great interest as anti-cancer drugs.^[2] Because of this, the total syntheses of these compounds is a major pursuit of organic chemists, and a number of different syntheses have been published in the chemical literature.